Welcome to Incels.is - Involuntary Celibate Forum

Welcome! This is a forum for involuntary celibates: people who lack a significant other. Are you lonely and wish you had someone in your life? You're not alone! Join our forum and talk to people just like you.

SuicideFuel Math thread problem (official)

Be P(x) = x^6 + bx^5 + cx^4 + dx^3 + ex^2 + fx + g a polinomial with integer coefficients and that P (sqrt(2) + cubic root(3)) = 0.

The polynomial R(x) is the remainder of the division of P(x) by x³ - 3x - 1.

Find the sum of the coefficients of R(x)
 
Last edited:
ye look at a grade 11 math text book for math 20-1 quadratic functions and equations you’ll find questions like ones I gave you
 
ye look at grade 11 math in Alberta quadratic functions and equations
Yeah I learned the same stuff as you in Grade 11. I only remembered now the Grade 9 questions you posted, you also have to do them in Grade 11-12, using the calculus way.
 
Be P(x) = x^6 + bx^5 + cx^4 + dx^3 + ex^2 + fx + g a polinomial with integer coefficients and that P (sqrt(2) + cubic root(3)) = 0.

The polynomial R(x) is the remainder of the division of P(x) by x³ - 3x - 1.

Find the sum of the coefficients of R(x)
Using that {1, sqrt(2), cbrt(3), cbrt(9), sqrt(2)*cbrt(3), sqrt(2)*cbrt(9)} is linearly independent over the rational numbers*, P(sqrt(2) + cbrt(3)) = 0 yields the following six equations in six unknowns:
  • 17 + 60b + 4c + 3d + 2e + g = 0
  • 120 + 4b + 12c + 2d + f = 0
  • 90 + 20b + 3c + 6d + f = 0
  • 60 + 3b + 12c + e = 0
  • 24 + 15b + 8c + 2e = 0
  • 18 + 20b + 3d = 0
This system of equations of course begs to be solved using linear algebra, which yields the following (unique) solution: b = 0, c = -6, d = -6, e = 12, f = -36, g = 1 -- i.e., p(x) = x^6 - 6x^4 - 6x^3 + 12x^2 - 36x + 1. Doing polynomial long division yields that R(x) = 3x^2 - 54x - 4, whose coefficients sum to -55.

* I highly recommend you to try and think about how one could prove that {1, sqrt(2), cbrt(3), cbrt(9), sqrt(2)*cbrt(3), sqrt(2)*cbrt(9)} is linearly independent over the rational numbers. It's pretty tricky, but really nice. Do let me know if you managed to figure it out.
 
Using that {1, sqrt(2), cbrt(3), cbrt(9), sqrt(2)*cbrt(3), sqrt(2)*cbrt(9)} is linearly independent over the rational numbers*, P(sqrt(2) + cbrt(3)) = 0 yields the following six equations in six unknowns:
  • 17 + 60b + 4c + 3d + 2e + g = 0
  • 120 + 4b + 12c + 2d + f = 0
  • 90 + 20b + 3c + 6d + f = 0
  • 60 + 3b + 12c + e = 0
  • 24 + 15b + 8c + 2e = 0
  • 18 + 20b + 3d = 0
This system of equations of course begs to be solved using linear algebra, which yields the following (unique) solution: b = 0, c = -6, d = -6, e = 12, f = -36, g = 1 -- i.e., p(x) = x^6 - 6x^4 - 6x^3 + 12x^2 - 36x + 1. Doing polynomial long division yields that R(x) = 3x^2 - 54x - 4, whose coefficients sum to -55.

* I highly recommend you to try and think about how one could prove that {1, sqrt(2), cbrt(3), cbrt(9), sqrt(2)*cbrt(3), sqrt(2)*cbrt(9)} is linearly independent over the rational numbers. It's pretty tricky, but really nice. Do let me know if you managed to figure it out.
Correct :feelsokman:

I can't prove that, I'm not on that level yet :feelsrope:
 
I can't prove that, I'm not on that level yet :feelsrope:
Provided you know what linear independence means, you should theoretically be able to do it if you understood what I did. It's not that much more difficult.
 
Math is for niggers
 
1677559938909

SOS HELP ME NIGGERS PLS PLS
 
Some nigger help now pls!!!! Thanks in advance,


despressed(not depressed) currycel1

1677559985731
 
SOMEONE PLS SEND HELP
 
Pls screen shot how you got that
(12-4x)(12-2x)=54
144-72x+8x^2=54
90-72x+8x^2=0
Solve for x using quadratic formula and you get 1.5 and 7.5
7.5 doesn't make sense so x is 1.5
then sub 1.5 in the first equation and you get your measurements.
 
Find X, given that 1/X = sin(pi/14)sin(3pi/14)sin(5pi/14)
 
This thread is so pozzed. None of these are math problems, they are lame exercises.
https://www.maa.org/external_archive/devlin/LockhartsLament.pdf
I only read bits and pieces of the article you linked. Regarding what you said, "problem" is often used synonymously with "exercise" in mathematics and physics. Besides, asking fellowcels to solve the Riemann Hypothesis or the Collatz conjecture is out of the question, so I'm not exactly sure what you wanted from this thread.
 
the article
Its not an article, its an essay. Articles are written and read by low IQ jews LARPing as high IQ intellectuals.
asking fellowcels to solve the Riemann Hypothesis or the Collatz conjecture is out of the question, so I'm not exactly sure what you wanted from this thread
It can be a simple question, like, which is true for the following:
View: https://imgur.com/a/rLZVleL
the circles in the left square have a greater, less great, or equal area to the circle in the right square.
"problem" is often used synonymously with "exercise" in mathematics and physics
I see your point
 
Its not an article, its an essay. Articles are written and read by low IQ jews LARPing as high IQ intellectuals.
Potayto potahto as far as I'm concerned. All I care about is the content.
It can be a simple question, like, which is true for the following:
View: https://imgur.com/a/rLZVleL
the circles in the left square have a greater, less great, or equal area to the circle in the right square.
I fail to see what distinguishes the problem (or whatever you wanna call it) you gave from the ones previously given in this thread. Not to mention, your problem is probably the easiest in the entire thread. The areas are obviously equal.
 
Potayto potahto as far as I'm concerned. All I care about is the content.

I fail to see what distinguishes the problem (or whatever you wanna call it) you gave from the ones previously given in this thread. Not to mention, your problem is probably the easiest in the entire thread. The areas are obviously equal.
1679131045631
solved (in video game)
 
I don't need this thread...
All I need to do is fucking ask @NoLooksNoLife



it's over
 
Find X: 1 + 2x + 3x² + 4x³ ... = 1/2 + 3/4 + 5/8 + 7/16 ...
 
Find X: 1 + 2x + 3x² + 4x³ ... = 1/2 + 3/4 + 5/8 + 7/16 ...
The right-hand side is presumably the sum of (2n-1)/2^n from n=1 to infinity, which is 4S-1, where S is the sum of n/2^(n+1) from n=1 to infinity, which, upon differentiating the identity y/(1-y) = sum of 1/y^n from y=1 to infinity w.r.t. y and subsequently plugging in y=2, is readily seen to be 1. As such, the right-hand side equals 4*1-1 = 3.

As for the left-hand side, differentiating the identity x/(1-x) = sum x^n for n=1 to infinity w.r.t. x readily yields that the left-hand side equals 1/(1-x)^2. Note that x needs to be between +1 & -1 for the left-hand side to be convergent. The original equation now becomes 1/(1-x)^2 = 3, which has solutions x = 1±1/√3. Since 1+1/√3 > 1, x = 1-1/√3.
 
The right-hand side is presumably the sum of (2n-1)/2^n from n=1 to infinity, which is 4S-1, where S is the sum of n/2^(n+1) from n=1 to infinity, which, upon differentiating the identity y/(1-y) = sum of 1/y^n from y=1 to infinity w.r.t. y and subsequently plugging in y=2, is readily seen to be 1. As such, the right-hand side equals 4*1-1 = 3.

As for the left-hand side, differentiating the identity x/(1-x) = sum x^n for n=1 to infinity w.r.t. x readily yields that the left-hand side equals 1/(1-x)^2. Note that x needs to be between +1 & -1 for the left-hand side to be convergent. The original equation now becomes 1/(1-x)^2 = 3, which has solutions x = 1±1/√3. Since 1+1/√3 > 1, x = 1-1/√3.
Correct :feelsokman:
 
can't relate to this thread a lot tbh since i was in a medicine college so no math:feelsjuice:
 
How much do you make?
i am not a doctor, i dropped out after 2 years of college because i was too deformed to fit in with other students.
my brother is still studying in STEM uni tho and will be going to work in US when he finish.
now i have a normal wageslave job and i make than half what i was going to make if i continues studying. i work in a big food company , probably will get a promotion by the end of 2023:feelsjuice:
 
Does math logic and theory of computations problems count as math problems? Such as lambda calculus and combined logic?
 
Does math logic and theory of computations problems count as math problems? Such as lambda calculus and combined logic?
I'd say so, but I doubt even most mathcels here are familiar with those topics.
 
A Turing machine is defined by the following scheme. Formulate an algorithm according to which this machine operates

1681562843280
 
I'd say so, but I doubt even most mathcels here are familiar with those topics.
Okay, thank you. Maybe someone will be interested in getting acquainted with those topics
 
Last edited:
Calculate the linear algorithmic complexity of the following Turing machine
1681563841794
 
Consider three sets E1 = {1, 2, 3}, F1 = {1, 3, 4} and G1 = {2, 3, 4, 5}. Two elements are chosen at random, without replacement, from the set E1 and let S1 denote the set of these chosen elements. Let E2 = E1 - S1 and F2 = F1 ∪ S1. Now, two elements are chosen at random, without replacement, from the set F2 and let S2 denote the set of these chosen elements. Let G2 = G1 ∪ S2. Finally, two elements are chosen at random, without replacement, from the set G2 and let S3 denote the set of these chosen elements. Let E3 = E2 ∪ S3. Given that E1 = E3, let p be the conditional probability of the event S1 = {1, 2}. Then the value of p is
 
A Turing machine is defined by the following scheme. Formulate an algorithm according to which this machine operates

View attachment 738404
While I have a passing familiarity with finite state automata and Turing machines, I'm at a bit of a loss regarding some of the conventions. Does the machine operate on finite binary strings? Is "B" a blank symbol? What happens when a state reads a symbol for which there's no arrow? Does it reject in that case?

If the answer to all of those questions is affirmative, then I believe the machine accepts only those strings of the form "some number of 0s followed by an equal number of 1s". Am I correct? :feelsaww:
 
Consider three sets E1 = {1, 2, 3}, F1 = {1, 3, 4} and G1 = {2, 3, 4, 5}. Two elements are chosen at random, without replacement, from the set E1 and let S1 denote the set of these chosen elements. Let E2 = E1 - S1 and F2 = F1 ∪ S1. Now, two elements are chosen at random, without replacement, from the set F2 and let S2 denote the set of these chosen elements. Let G2 = G1 ∪ S2. Finally, two elements are chosen at random, without replacement, from the set G2 and let S3 denote the set of these chosen elements. Let E3 = E2 ∪ S3. Given that E1 = E3, let p be the conditional probability of the event S1 = {1, 2}. Then the value of p is
5/26 I believe.
 

Similar threads

AsiaCel
Replies
6
Views
758
cirno369
cirno369
S
Replies
35
Views
2K
mirinthatrope
mirinthatrope
I_like_pizza
Replies
11
Views
866
Misogynist Vegeta
Misogynist Vegeta
ANTAGONIST
Replies
7
Views
1K
The Notorious SLAV
The Notorious SLAV
WastedPotential
Replies
23
Views
1K
SewerPolarKoala
SewerPolarKoala

Users who are viewing this thread

shape1
shape2
shape3
shape4
shape5
shape6
Back
Top